C24H22F2N4 — CID 26320088
(3R)-N-(3,4-difluorophenyl)-1-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methyl]piperidin-3-amine (PubChem CID 26320088) has the molecular formula C24H22F2N4 and a molecular weight of 404.46 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-1-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methyl]piperidin-3-amine.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-1-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 26320088 |
| Molecular Formula | C24H22F2N4 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-1-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methyl]piperidin-3-amine |
| SMILES | Fc1ccc(N[C@@H]2CCCN(Cc3ccc(C#Cc4cncnc4)cc3)C2)cc1F |
| InChI | InChI=1S/C24H22F2N4/c25-23-10-9-21(12-24(23)26)29-22-2-1-11-30(16-22)15-19-6-3-18(4-7-19)5-8-20-13-27-17-28-14-20/h3-4,6-7,9-10,12-14,17,22,29H,1-2,11,15-16H2/t22-/m1/s1 |
| InChIKey | NFKIJFHTVCDVKQ-JOCHJYFZSA-N |
| XLogP | 4.23 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|