C16H18BrFN4 — CID 172902398
N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine (PubChem CID 172902398) has the molecular formula C16H18BrFN4 and a molecular weight of 365.25 g/mol. Its IUPAC name is N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172902398 |
| Molecular Formula | C16H18BrFN4 |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-4-amine |
| SMILES | Fc1ccc(CN2CCCC(Nc3ccncn3)C2)cc1Br |
| InChI | InChI=1S/C16H18BrFN4/c17-14-8-12(3-4-15(14)18)9-22-7-1-2-13(10-22)21-16-5-6-19-11-20-16/h3-6,8,11,13H,1-2,7,9-10H2,(H,19,20,21) |
| InChIKey | NCVQSZLIVGTOBM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |