C17H20BrFN4 — CID 172902521
N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylpyrimidin-4-amine (PubChem CID 172902521) has the molecular formula C17H20BrFN4 and a molecular weight of 379.28 g/mol. Its IUPAC name is N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylpyrimidin-4-amine.
| Compound Name | N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172902521 |
| Molecular Formula | C17H20BrFN4 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylpyrimidin-4-amine |
| SMILES | CN(c1ccncn1)C1CCCN(Cc2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C17H20BrFN4/c1-22(17-6-7-20-12-21-17)14-3-2-8-23(11-14)10-13-4-5-16(19)15(18)9-13/h4-7,9,12,14H,2-3,8,10-11H2,1H3 |
| InChIKey | PUZIBYRTPZOFSM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |