C19H26N6O2 — CID 172893202
4-N,6-N,6-N-trimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-3-yl]pyrimidine-4,6-diamine (PubChem CID 172893202) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-N,6-N,6-N-trimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-3-yl]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N,6-N-trimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-3-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 172893202 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-N,6-N,6-N-trimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-3-yl]pyrimidine-4,6-diamine |
| SMILES | CN(C)c1cc(N(C)C2CCCN(Cc3ccc([N+](=O)[O-])cc3)C2)ncn1 |
| InChI | InChI=1S/C19H26N6O2/c1-22(2)18-11-19(21-14-20-18)23(3)17-5-4-10-24(13-17)12-15-6-8-16(9-7-15)25(26)27/h6-9,11,14,17H,4-5,10,12-13H2,1-3H3 |
| InChIKey | IIXPGIVZAXPGBJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|