C20H24F2N2O2 — CID 42213563
2-[2-[[(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenoxy]ethanol (PubChem CID 42213563) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[2-[[(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 42213563 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[2-[[(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1CN1CCC[C@H](Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H24F2N2O2/c21-18-8-7-16(12-19(18)22)23-17-5-3-9-24(14-17)13-15-4-1-2-6-20(15)26-11-10-25/h1-2,4,6-8,12,17,23,25H,3,5,9-11,13-14H2/t17-/m0/s1 |
| InChIKey | LUELLEGLYPPFCN-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |