C16H18ClFN4 — CID 122557818
5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 122557818) has the molecular formula C16H18ClFN4 and a molecular weight of 320.80 g/mol. Its IUPAC name is 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122557818 |
| Molecular Formula | C16H18ClFN4 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Fc1ccccc1CN1CCCC(Nc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C16H18ClFN4/c17-13-8-19-16(20-9-13)21-14-5-3-7-22(11-14)10-12-4-1-2-6-15(12)18/h1-2,4,6,8-9,14H,3,5,7,10-11H2,(H,19,20,21) |
| InChIKey | SGPUUURULRYKLW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |