C17H20ClFN4 — CID 155981420
5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylpyrimidin-2-amine (PubChem CID 155981420) has the molecular formula C17H20ClFN4 and a molecular weight of 334.83 g/mol. Its IUPAC name is 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylpyrimidin-2-amine.
| Compound Name | 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 155981420 |
| Molecular Formula | C17H20ClFN4 |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-chloro-N-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylpyrimidin-2-amine |
| SMILES | CN(c1ncc(Cl)cn1)C1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H20ClFN4/c1-22(17-20-10-14(18)11-21-17)15-6-8-23(9-7-15)12-13-4-2-3-5-16(13)19/h2-5,10-11,15H,6-9,12H2,1H3 |
| InChIKey | ZSSZZKDYXHUTNY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |