C15H18FN5 — CID 122558298
5-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 122558298) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122558298 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-fluoro-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Fc1cnc(NC2CCCN(Cc3cccnc3)C2)nc1 |
| InChI | InChI=1S/C15H18FN5/c16-13-8-18-15(19-9-13)20-14-4-2-6-21(11-14)10-12-3-1-5-17-7-12/h1,3,5,7-9,14H,2,4,6,10-11H2,(H,18,19,20) |
| InChIKey | JCISVZFLZBCZSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |