C16H25N3S2 — CID 122555983
N-(1,4-dithiepan-6-yl)-1-(pyridin-3-ylmethyl)piperidin-3-amine (PubChem CID 122555983) has the molecular formula C16H25N3S2 and a molecular weight of 323.53 g/mol. Its IUPAC name is N-(1,4-dithiepan-6-yl)-1-(pyridin-3-ylmethyl)piperidin-3-amine.
| Compound Name | N-(1,4-dithiepan-6-yl)-1-(pyridin-3-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 122555983 |
| Molecular Formula | C16H25N3S2 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(1,4-dithiepan-6-yl)-1-(pyridin-3-ylmethyl)piperidin-3-amine |
| SMILES | c1cncc(CN2CCCC(NC3CSCCSC3)C2)c1 |
| InChI | InChI=1S/C16H25N3S2/c1-3-14(9-17-5-1)10-19-6-2-4-15(11-19)18-16-12-20-7-8-21-13-16/h1,3,5,9,15-16,18H,2,4,6-8,10-13H2 |
| InChIKey | CGPULQDVDNIUOZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |