C16H19FN4 — CID 115749931
N-(1-benzylpiperidin-3-yl)-5-fluoropyrimidin-2-amine (PubChem CID 115749931) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-5-fluoropyrimidin-2-amine.
| Compound Name | N-(1-benzylpiperidin-3-yl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 115749931 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-5-fluoropyrimidin-2-amine |
| SMILES | Fc1cnc(NC2CCCN(Cc3ccccc3)C2)nc1 |
| InChI | InChI=1S/C16H19FN4/c17-14-9-18-16(19-10-14)20-15-7-4-8-21(12-15)11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15H,4,7-8,11-12H2,(H,18,19,20) |
| InChIKey | BWXAWGBPRKSUMQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |