C20H23N5 — CID 99780455
2-N-[(3R)-1-benzylpiperidin-3-yl]quinazoline-2,4-diamine (PubChem CID 99780455) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-N-[(3R)-1-benzylpiperidin-3-yl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[(3R)-1-benzylpiperidin-3-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 99780455 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-N-[(3R)-1-benzylpiperidin-3-yl]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N[C@@H]2CCCN(Cc3ccccc3)C2)nc2ccccc12 |
| InChI | InChI=1S/C20H23N5/c21-19-17-10-4-5-11-18(17)23-20(24-19)22-16-9-6-12-25(14-16)13-15-7-2-1-3-8-15/h1-5,7-8,10-11,16H,6,9,12-14H2,(H3,21,22,23,24)/t16-/m1/s1 |
| InChIKey | JDRYRVCALDCSLH-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |