C15H21N5 — CID 67720732
2-N-[4-(aminomethyl)cyclohexyl]quinazoline-2,4-diamine (PubChem CID 67720732) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-N-[4-(aminomethyl)cyclohexyl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[4-(aminomethyl)cyclohexyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 67720732 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-N-[4-(aminomethyl)cyclohexyl]quinazoline-2,4-diamine |
| SMILES | NCC1CCC(Nc2nc(N)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C15H21N5/c16-9-10-5-7-11(8-6-10)18-15-19-13-4-2-1-3-12(13)14(17)20-15/h1-4,10-11H,5-9,16H2,(H3,17,18,19,20) |
| InChIKey | VFCSMKCYWWWNJB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |