C23H30N6 — CID 89376623
2-N-[4-[(4-aminophenyl)methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 89376623) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 2-N-[4-[(4-aminophenyl)methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 2-N-[4-[(4-aminophenyl)methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 89376623 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2-N-[4-[(4-aminophenyl)methylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(NC2CCC(NCc3ccc(N)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H30N6/c1-29(2)22-20-5-3-4-6-21(20)27-23(28-22)26-19-13-11-18(12-14-19)25-15-16-7-9-17(24)10-8-16/h3-10,18-19,25H,11-15,24H2,1-2H3,(H,26,27,28) |
| InChIKey | AFQFTZBISLOUIT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|