C25H33Cl2F2N5 — CID 68848328
2-N-[4-[3-(3,4-difluorophenyl)propylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;dihydrochloride (PubChem CID 68848328) has the molecular formula C25H33Cl2F2N5 and a molecular weight of 512.48 g/mol. Its IUPAC name is 2-N-[4-[3-(3,4-difluorophenyl)propylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;dihydrochloride.
| Compound Name | 2-N-[4-[3-(3,4-difluorophenyl)propylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 68848328 |
| Molecular Formula | C25H33Cl2F2N5 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-N-[4-[3-(3,4-difluorophenyl)propylamino]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine;dihydrochloride |
| SMILES | CN(C)c1nc(NC2CCC(NCCCc3ccc(F)c(F)c3)CC2)nc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C25H31F2N5.2ClH/c1-32(2)24-20-7-3-4-8-23(20)30-25(31-24)29-19-12-10-18(11-13-19)28-15-5-6-17-9-14-21(26)22(27)16-17;;/h3-4,7-9,14,16,18-19,28H,5-6,10-13,15H2,1-2H3,(H,29,30,31);2*1H |
| InChIKey | MVZWORDGGFAIND-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|