C24H26F2N4O2 — CID 68885559
[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl 3,4-difluorobenzoate (PubChem CID 68885559) has the molecular formula C24H26F2N4O2 and a molecular weight of 440.49 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl 3,4-difluorobenzoate.
| Compound Name | [4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 68885559 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl 3,4-difluorobenzoate |
| SMILES | CN(C)c1nc(NC2CCC(COC(=O)c3ccc(F)c(F)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H26F2N4O2/c1-30(2)22-18-5-3-4-6-21(18)28-24(29-22)27-17-10-7-15(8-11-17)14-32-23(31)16-9-12-19(25)20(26)13-16/h3-6,9,12-13,15,17H,7-8,10-11,14H2,1-2H3,(H,27,28,29) |
| InChIKey | URYWSIAYKMRPGM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |