C24H26ClF2N5O — CID 68886216
N-[(3-chloro-2,6-difluorophenyl)methyl]-4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 68886216) has the molecular formula C24H26ClF2N5O and a molecular weight of 473.96 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]-4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 68886216 |
| Molecular Formula | C24H26ClF2N5O |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | CN(C)c1nc(NC2CCC(C(=O)NCc3c(F)ccc(Cl)c3F)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H26ClF2N5O/c1-32(2)22-16-5-3-4-6-20(16)30-24(31-22)29-15-9-7-14(8-10-15)23(33)28-13-17-19(26)12-11-18(25)21(17)27/h3-6,11-12,14-15H,7-10,13H2,1-2H3,(H,28,33)(H,29,30,31) |
| InChIKey | JAAWDQXHLRKEAN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|