C24H31F4N5 — CID 142229564
4-N,4-N-dimethyl-2-N-[4-[[(2,3,5,6-tetrafluorophenyl)methylamino]methyl]cyclohexyl]quinazoline-2,4-diamine;molecular hydrogen (PubChem CID 142229564) has the molecular formula C24H31F4N5 and a molecular weight of 465.54 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-[4-[[(2,3,5,6-tetrafluorophenyl)methylamino]methyl]cyclohexyl]quinazoline-2,4-diamine;molecular hydrogen.
| Compound Name | 4-N,4-N-dimethyl-2-N-[4-[[(2,3,5,6-tetrafluorophenyl)methylamino]methyl]cyclohexyl]quinazoline-2,4-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 142229564 |
| Molecular Formula | C24H31F4N5 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-[4-[[(2,3,5,6-tetrafluorophenyl)methylamino]methyl]cyclohexyl]quinazoline-2,4-diamine;molecular hydrogen |
| SMILES | CN(C)c1nc(NC2CCC(CNCc3c(F)c(F)cc(F)c3F)CC2)nc2ccccc12.[H][H].[H][H] |
| InChI | InChI=1S/C24H27F4N5.2H2/c1-33(2)23-16-5-3-4-6-20(16)31-24(32-23)30-15-9-7-14(8-10-15)12-29-13-17-21(27)18(25)11-19(26)22(17)28;;/h3-6,11,14-15,29H,7-10,12-13H2,1-2H3,(H,30,31,32);2*1H |
| InChIKey | UOFLXPUKSXVPGM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|