C26H34F3N5O2 — CID 157173583
2-[[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methylamino]methyl]-4-(trifluoromethoxy)phenol;methane (PubChem CID 157173583) has the molecular formula C26H34F3N5O2 and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-[[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methylamino]methyl]-4-(trifluoromethoxy)phenol;methane.
| Compound Name | 2-[[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methylamino]methyl]-4-(trifluoromethoxy)phenol;methane |
|---|---|
| PubChem CID | 157173583 |
| Molecular Formula | C26H34F3N5O2 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 2-[[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methylamino]methyl]-4-(trifluoromethoxy)phenol;methane |
| SMILES | C.CN(C)c1nc(NC2CCC(CNCc3cc(OC(F)(F)F)ccc3O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H30F3N5O2.CH4/c1-33(2)23-20-5-3-4-6-21(20)31-24(32-23)30-18-9-7-16(8-10-18)14-29-15-17-13-19(11-12-22(17)34)35-25(26,27)28;/h3-6,11-13,16,18,29,34H,7-10,14-15H2,1-2H3,(H,30,31,32);1H4 |
| InChIKey | ANTGFVQKGSPTCZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|