C24H32N6 — CID 89376599
2-N-[4-[[(4-aminophenyl)methylamino]methyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 89376599) has the molecular formula C24H32N6 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-N-[4-[[(4-aminophenyl)methylamino]methyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 2-N-[4-[[(4-aminophenyl)methylamino]methyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 89376599 |
| Molecular Formula | C24H32N6 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2-N-[4-[[(4-aminophenyl)methylamino]methyl]cyclohexyl]-4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(NC2CCC(CNCc3ccc(N)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H32N6/c1-30(2)23-21-5-3-4-6-22(21)28-24(29-23)27-20-13-9-18(10-14-20)16-26-15-17-7-11-19(25)12-8-17/h3-8,11-12,18,20,26H,9-10,13-16,25H2,1-2H3,(H,27,28,29) |
| InChIKey | PGINSUABVZKINP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|