C25H38N6S — CID 87612122
1-(cyclohexylmethyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea (PubChem CID 87612122) has the molecular formula C25H38N6S and a molecular weight of 454.69 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea.
| Compound Name | 1-(cyclohexylmethyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 87612122 |
| Molecular Formula | C25H38N6S |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(CNC(=S)NCC3CCCCC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H38N6S/c1-31(2)23-21-10-6-7-11-22(21)29-24(30-23)28-20-14-12-19(13-15-20)17-27-25(32)26-16-18-8-4-3-5-9-18/h6-7,10-11,18-20H,3-5,8-9,12-17H2,1-2H3,(H2,26,27,32)(H,28,29,30) |
| InChIKey | LEXFKPCZHLRNIP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|