C22H28N6OS — CID 69479097
1-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-3-thiophen-3-ylurea (PubChem CID 69479097) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-3-thiophen-3-ylurea.
| Compound Name | 1-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 69479097 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-3-thiophen-3-ylurea |
| SMILES | CN(C)c1nc(NC2CCC(CNC(=O)Nc3ccsc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H28N6OS/c1-28(2)20-18-5-3-4-6-19(18)26-21(27-20)24-16-9-7-15(8-10-16)13-23-22(29)25-17-11-12-30-14-17/h3-6,11-12,14-16H,7-10,13H2,1-2H3,(H2,23,25,29)(H,24,26,27) |
| InChIKey | STPXBEAJACWJOX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |