C31H36N6O — CID 69473453
1-benzhydryl-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]urea (PubChem CID 69473453) has the molecular formula C31H36N6O and a molecular weight of 508.67 g/mol. Its IUPAC name is 1-benzhydryl-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]urea.
| Compound Name | 1-benzhydryl-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 69473453 |
| Molecular Formula | C31H36N6O |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 1-benzhydryl-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]urea |
| SMILES | CN(C)c1nc(NC2CCC(CNC(=O)NC(c3ccccc3)c3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C31H36N6O/c1-37(2)29-26-15-9-10-16-27(26)34-30(36-29)33-25-19-17-22(18-20-25)21-32-31(38)35-28(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-16,22,25,28H,17-21H2,1-2H3,(H2,32,35,38)(H,33,34,36) |
| InChIKey | QFQIHQDRYZJDHU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |