C18H24N6O — CID 135543905
1-cyclohexyl-3-[(E)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]urea (PubChem CID 135543905) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-cyclohexyl-3-[(E)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135543905 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]urea |
| SMILES | Cc1ccc2nc(/N=C(\N)NC(=O)NC3CCCCC3)nc(C)c2c1 |
| InChI | InChI=1S/C18H24N6O/c1-11-8-9-15-14(10-11)12(2)20-17(22-15)23-16(19)24-18(25)21-13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3,(H4,19,20,21,22,23,24,25) |
| InChIKey | IJFNMWRASZLSEN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|