C11H13N5 — CID 2849032
2-(4,8-dimethylquinazolin-2-yl)guanidine (PubChem CID 2849032) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-(4,8-dimethylquinazolin-2-yl)guanidine.
| Compound Name | 2-(4,8-dimethylquinazolin-2-yl)guanidine |
|---|---|
| PubChem CID | 2849032 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-(4,8-dimethylquinazolin-2-yl)guanidine |
| SMILES | Cc1nc(N=C(N)N)nc2c(C)cccc12 |
| InChI | InChI=1S/C11H13N5/c1-6-4-3-5-8-7(2)14-11(15-9(6)8)16-10(12)13/h3-5H,1-2H3,(H4,12,13,14,15,16) |
| InChIKey | ZZFRROOYRMMSET-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|