C26H41N5O — CID 142230266
N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]nonanamide (PubChem CID 142230266) has the molecular formula C26H41N5O and a molecular weight of 439.65 g/mol. Its IUPAC name is N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]nonanamide.
| Compound Name | N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]nonanamide |
|---|---|
| PubChem CID | 142230266 |
| Molecular Formula | C26H41N5O |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCC1CCC(Nc2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H41N5O/c1-4-5-6-7-8-9-14-24(32)27-19-20-15-17-21(18-16-20)28-26-29-23-13-11-10-12-22(23)25(30-26)31(2)3/h10-13,20-21H,4-9,14-19H2,1-3H3,(H,27,32)(H,28,29,30) |
| InChIKey | VHZDAKJTZHPXPQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|