C30H42N4O2 — CID 142230983
N-[(4-ethylcyclohexyl)methyl]-4-phenoxybutanamide;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142230983) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is N-[(4-ethylcyclohexyl)methyl]-4-phenoxybutanamide;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | N-[(4-ethylcyclohexyl)methyl]-4-phenoxybutanamide;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142230983 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | N-[(4-ethylcyclohexyl)methyl]-4-phenoxybutanamide;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CCC1CCC(CNC(=O)CCCOc2ccccc2)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C19H29NO2.C11H13N3/c1-2-16-10-12-17(13-11-16)15-20-19(21)9-6-14-22-18-7-4-3-5-8-18;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h3-5,7-8,16-17H,2,6,9-15H2,1H3,(H,20,21);4-7H,1-3H3 |
| InChIKey | XIMUYCWABHDUBS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|