C28H38N4O — CID 142229062
N-(4-methylcyclohexyl)-4-phenylbutanamide;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142229062) has the molecular formula C28H38N4O and a molecular weight of 446.64 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-4-phenylbutanamide;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | N-(4-methylcyclohexyl)-4-phenylbutanamide;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142229062 |
| Molecular Formula | C28H38N4O |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | N-(4-methylcyclohexyl)-4-phenylbutanamide;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC1CCC(NC(=O)CCCc2ccccc2)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C17H25NO.C11H13N3/c1-14-10-12-16(13-11-14)18-17(19)9-5-8-15-6-3-2-4-7-15;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h2-4,6-7,14,16H,5,8-13H2,1H3,(H,18,19);4-7H,1-3H3 |
| InChIKey | MTADAJBLKDKBRZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |