C41H46Cl3N3O — CID 142228370
1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine;4,4,4-tris(4-chlorophenyl)butan-2-one (PubChem CID 142228370) has the molecular formula C41H46Cl3N3O and a molecular weight of 703.20 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine;4,4,4-tris(4-chlorophenyl)butan-2-one.
| Compound Name | 1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine;4,4,4-tris(4-chlorophenyl)butan-2-one |
|---|---|
| PubChem CID | 142228370 |
| Molecular Formula | C41H46Cl3N3O |
| Molecular Weight | 703.20 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | 1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine;4,4,4-tris(4-chlorophenyl)butan-2-one |
| SMILES | CC(=O)CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.CC1CCC(C)CC1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C22H17Cl3O.C11H13N3.C8H16/c1-15(26)14-22(16-2-8-19(23)9-3-16,17-4-10-20(24)11-5-17)18-6-12-21(25)13-7-18;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-7-3-5-8(2)6-4-7/h2-13H,14H2,1H3;4-7H,1-3H3;7-8H,3-6H2,1-2H3 |
| InChIKey | WFEVNGBAQRSLTE-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.20 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|