C33H48ClN5O — CID 142230372
(E)-4-(N-amino-4-chloroanilino)-3-methylhept-3-en-2-one;1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine (PubChem CID 142230372) has the molecular formula C33H48ClN5O and a molecular weight of 566.23 g/mol. Its IUPAC name is (E)-4-(N-amino-4-chloroanilino)-3-methylhept-3-en-2-one;1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine.
| Compound Name | (E)-4-(N-amino-4-chloroanilino)-3-methylhept-3-en-2-one;1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142230372 |
| Molecular Formula | C33H48ClN5O |
| Molecular Weight | 566.23 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | (E)-4-(N-amino-4-chloroanilino)-3-methylhept-3-en-2-one;1,4-dimethylcyclohexane;N,N,2-trimethylquinazolin-4-amine |
| SMILES | CC1CCC(C)CC1.CCC/C(=C(/C)C(C)=O)N(N)c1ccc(Cl)cc1.Cc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C14H19ClN2O.C11H13N3.C8H16/c1-4-5-14(10(2)11(3)18)17(16)13-8-6-12(15)7-9-13;1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-7-3-5-8(2)6-4-7/h6-9H,4-5,16H2,1-3H3;4-7H,1-3H3;7-8H,3-6H2,1-2H3/b14-10+;; |
| InChIKey | SMWJLYPBTFEWKW-YZEJZXAXSA-N |
| XLogP | 8.52 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.23 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|