C26H33N5O — CID 163863609
N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2-methylphenyl)propanamide (PubChem CID 163863609) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2-methylphenyl)propanamide.
| Compound Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 163863609 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1CCC(=O)NC1CCC(Nc2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H33N5O/c1-18-8-4-5-9-19(18)12-17-24(32)27-20-13-15-21(16-14-20)28-26-29-23-11-7-6-10-22(23)25(30-26)31(2)3/h4-11,20-21H,12-17H2,1-3H3,(H,27,32)(H,28,29,30) |
| InChIKey | PESBPMCBFPFYEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |