About [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid
[4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid (PubChem CID 69014011) has the molecular formula C23H27N5O2
and a molecular weight of 405.50 g/mol. Its IUPAC name is [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid |
| PubChem CID | 69014011 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid |
| SMILES | Cc1ccccc1N(C)c1nc(NC2CCC(NC(=O)O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H27N5O2/c1-15-7-3-6-10-20(15)28(2)21-18-8-4-5-9-19(18)26-22(27-21)24-16-11-13-17(14-12-16)25-23(29)30/h3-10,16-17,25H,11-14H2,1-2H3,(H,29,30)(H,24,26,27) |
| InChIKey | SCEUMJSAEJEYGG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid?
The IUPAC name of [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid (CID 69014011) is [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid.
What is the SMILES notation for [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid?
The canonical SMILES for [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid is Cc1ccccc1N(C)c1nc(NC2CCC(NC(=O)O)CC2)nc2ccccc12.
What is the InChIKey of [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid?
The InChIKey is SCEUMJSAEJEYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N5O2/c1-15-7-3-6-10-20(15)28(2)21-18-8-4-5-9-19(18)26-22(27-21)24-16-11-13-17(14-12-16)25-23(29)30/h3-10,16-17,25H,11-14H2,1-2H3,(H,29,30)(H,24,26,27).
What are the key properties of [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid?
[4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid has a molecular weight of 405.50 g/mol, XLogP of 4.70, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(N,2-dimethylanilino)quinazolin-2-yl]amino]cyclohexyl]carbamic acid is sourced from PubChem (CID 69014011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).