C31H33N5O2 — CID 10164382
N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-2-(4-methylbenzoyl)benzamide (PubChem CID 10164382) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-2-(4-methylbenzoyl)benzamide.
| Compound Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-2-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 10164382 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-2-(4-methylbenzoyl)benzamide |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)NC2CCC(Nc3nc(N(C)C)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C31H33N5O2/c1-20-12-14-21(15-13-20)28(37)24-8-4-5-9-25(24)30(38)32-22-16-18-23(19-17-22)33-31-34-27-11-7-6-10-26(27)29(35-31)36(2)3/h4-15,22-23H,16-19H2,1-3H3,(H,32,38)(H,33,34,35) |
| InChIKey | PJSOOQFGXUEYMV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |