C21H24IN5O2 — CID 70995699
N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-5-iodofuran-2-carboxamide (PubChem CID 70995699) has the molecular formula C21H24IN5O2 and a molecular weight of 505.36 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-5-iodofuran-2-carboxamide.
| Compound Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-5-iodofuran-2-carboxamide |
|---|---|
| PubChem CID | 70995699 |
| Molecular Formula | C21H24IN5O2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-5-iodofuran-2-carboxamide |
| SMILES | CN(C)c1nc(NC2CCC(NC(=O)c3ccc(I)o3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C21H24IN5O2/c1-27(2)19-15-5-3-4-6-16(15)25-21(26-19)24-14-9-7-13(8-10-14)23-20(28)17-11-12-18(22)29-17/h3-6,11-14H,7-10H2,1-2H3,(H,23,28)(H,24,25,26) |
| InChIKey | TXIGQAKZUDMDNK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|