C20H28N6S — CID 87612634
1-cyclopropyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 87612634) has the molecular formula C20H28N6S and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 87612634 |
| Molecular Formula | C20H28N6S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-cyclopropyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)NC3CC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H28N6S/c1-26(2)18-16-5-3-4-6-17(16)24-19(25-18)21-13-7-9-14(10-8-13)22-20(27)23-15-11-12-15/h3-6,13-15H,7-12H2,1-2H3,(H,21,24,25)(H2,22,23,27) |
| InChIKey | LCTWKIZZIBVGBF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|