C26H32N6O2S — CID 87613405
ethyl 3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]carbamothioylamino]benzoate (PubChem CID 87613405) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is ethyl 3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 87613405 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | ethyl 3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NC2CCC(Nc3nc(N(C)C)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C26H32N6O2S/c1-4-34-24(33)17-8-7-9-20(16-17)29-26(35)28-19-14-12-18(13-15-19)27-25-30-22-11-6-5-10-21(22)23(31-25)32(2)3/h5-11,16,18-19H,4,12-15H2,1-3H3,(H,27,30,31)(H2,28,29,35) |
| InChIKey | XBKKTSGMAPVAJQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|