C25H32N6S — CID 87848678
1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-[(3-methylphenyl)methyl]thiourea (PubChem CID 87848678) has the molecular formula C25H32N6S and a molecular weight of 448.64 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-[(3-methylphenyl)methyl]thiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-[(3-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 87848678 |
| Molecular Formula | C25H32N6S |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-[(3-methylphenyl)methyl]thiourea |
| SMILES | Cc1cccc(CNC(=S)NC2CCC(Nc3nc(N(C)C)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C25H32N6S/c1-17-7-6-8-18(15-17)16-26-25(32)28-20-13-11-19(12-14-20)27-24-29-22-10-5-4-9-21(22)23(30-24)31(2)3/h4-10,15,19-20H,11-14,16H2,1-3H3,(H2,26,28,32)(H,27,29,30) |
| InChIKey | DQUPYFFHABHKNT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|