C22H32N6S — CID 87612155
1-cyclopentyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 87612155) has the molecular formula C22H32N6S and a molecular weight of 412.61 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 87612155 |
| Molecular Formula | C22H32N6S |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-cyclopentyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)NC3CCCC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H32N6S/c1-28(2)20-18-9-5-6-10-19(18)26-21(27-20)23-16-11-13-17(14-12-16)25-22(29)24-15-7-3-4-8-15/h5-6,9-10,15-17H,3-4,7-8,11-14H2,1-2H3,(H,23,26,27)(H2,24,25,29) |
| InChIKey | IEYQCNHIJUZKOM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|