C23H25Br3N6S — CID 11490753
1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea (PubChem CID 11490753) has the molecular formula C23H25Br3N6S and a molecular weight of 657.27 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea |
|---|---|
| PubChem CID | 11490753 |
| Molecular Formula | C23H25Br3N6S |
| Molecular Weight | 657.27 g/mol |
| Exact Mass | 653.94 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)Nc3c(Br)cc(Br)cc3Br)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H25Br3N6S/c1-32(2)21-16-5-3-4-6-19(16)29-22(31-21)27-14-7-9-15(10-8-14)28-23(33)30-20-17(25)11-13(24)12-18(20)26/h3-6,11-12,14-15H,7-10H2,1-2H3,(H,27,29,31)(H2,28,30,33) |
| InChIKey | BKUNIRBSNOUNBC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.27 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|