C23H24Cl4N6O — CID 11489612
1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,3,5,6-tetrachlorophenyl)urea (PubChem CID 11489612) has the molecular formula C23H24Cl4N6O and a molecular weight of 542.30 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,3,5,6-tetrachlorophenyl)urea.
| Compound Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,3,5,6-tetrachlorophenyl)urea |
|---|---|
| PubChem CID | 11489612 |
| Molecular Formula | C23H24Cl4N6O |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3-(2,3,5,6-tetrachlorophenyl)urea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=O)Nc3c(Cl)c(Cl)cc(Cl)c3Cl)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H24Cl4N6O/c1-33(2)21-14-5-3-4-6-17(14)30-22(32-21)28-12-7-9-13(10-8-12)29-23(34)31-20-18(26)15(24)11-16(25)19(20)27/h3-6,11-13H,7-10H2,1-2H3,(H,28,30,32)(H2,29,31,34) |
| InChIKey | CNQHJGHMVDPCRJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|