C25H38N6S — CID 87612310
1-cyclooctyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 87612310) has the molecular formula C25H38N6S and a molecular weight of 454.69 g/mol. Its IUPAC name is 1-cyclooctyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-cyclooctyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 87612310 |
| Molecular Formula | C25H38N6S |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1-cyclooctyl-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)NC3CCCCCCC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H38N6S/c1-31(2)23-21-12-8-9-13-22(21)29-24(30-23)26-19-14-16-20(17-15-19)28-25(32)27-18-10-6-4-3-5-7-11-18/h8-9,12-13,18-20H,3-7,10-11,14-17H2,1-2H3,(H,26,29,30)(H2,27,28,32) |
| InChIKey | LHNVOBIKKZIFFX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|