C24H35N5O — CID 142228752
N-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]cyclohexanecarboxamide (PubChem CID 142228752) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is N-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 142228752 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N-[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]cyclohexanecarboxamide |
| SMILES | CN(C)c1nc(NCC2CCC(NC(=O)C3CCCCC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H35N5O/c1-29(2)22-20-10-6-7-11-21(20)27-24(28-22)25-16-17-12-14-19(15-13-17)26-23(30)18-8-4-3-5-9-18/h6-7,10-11,17-19H,3-5,8-9,12-16H2,1-2H3,(H,26,30)(H,25,27,28) |
| InChIKey | OFDOIWHMVZFZCK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |