C26H37N5O — CID 142228886
2-(cyclohexen-1-yl)-N-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]acetamide (PubChem CID 142228886) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 142228886 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]acetamide |
| SMILES | CN(C)c1nc(NCC2CCC(CNC(=O)CC3=CCCCC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H37N5O/c1-31(2)25-22-10-6-7-11-23(22)29-26(30-25)28-18-21-14-12-20(13-15-21)17-27-24(32)16-19-8-4-3-5-9-19/h6-8,10-11,20-21H,3-5,9,12-18H2,1-2H3,(H,27,32)(H,28,29,30) |
| InChIKey | XAFRTDBWWZJKQD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|