C15H25NO2 — CID 106121943
2-(cyclohexen-1-yl)-N-[(4-hydroxycyclohexyl)methyl]acetamide (PubChem CID 106121943) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(4-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(4-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 106121943 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(4-hydroxycyclohexyl)methyl]acetamide |
| SMILES | O=C(CC1=CCCCC1)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C15H25NO2/c17-14-8-6-13(7-9-14)11-16-15(18)10-12-4-2-1-3-5-12/h4,13-14,17H,1-3,5-11H2,(H,16,18) |
| InChIKey | KVYNBKHXVPAQTE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|