C14H22N2O2 — CID 71989735
2-[[2-(cyclohexen-1-yl)acetyl]amino]cyclopentane-1-carboxamide (PubChem CID 71989735) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[[2-(cyclohexen-1-yl)acetyl]amino]cyclopentane-1-carboxamide.
| Compound Name | 2-[[2-(cyclohexen-1-yl)acetyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 71989735 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[[2-(cyclohexen-1-yl)acetyl]amino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1CCCC1NC(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C14H22N2O2/c15-14(18)11-7-4-8-12(11)16-13(17)9-10-5-2-1-3-6-10/h5,11-12H,1-4,6-9H2,(H2,15,18)(H,16,17) |
| InChIKey | MNXGHNIPCKLPEU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|