C22H37N5S — CID 142228536
N-butylsulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 142228536) has the molecular formula C22H37N5S and a molecular weight of 403.64 g/mol. Its IUPAC name is N-butylsulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | N-butylsulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142228536 |
| Molecular Formula | C22H37N5S |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | N-butylsulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CCCCSNC.CN(C)c1nc(NCC2CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C17H24N4.C5H13NS/c1-21(2)16-14-10-6-7-11-15(14)19-17(20-16)18-12-13-8-4-3-5-9-13;1-3-4-5-7-6-2/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,18,19,20);6H,3-5H2,1-2H3 |
| InChIKey | IAVLJLIWQFGDBD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|