C27H36F3N5 — CID 142230606
N-(cyclohexylmethyl)-2-[2-(trifluoromethyl)phenyl]ethanamine;2-N,4-N,4-N-trimethylquinazoline-2,4-diamine (PubChem CID 142230606) has the molecular formula C27H36F3N5 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2-(trifluoromethyl)phenyl]ethanamine;2-N,4-N,4-N-trimethylquinazoline-2,4-diamine.
| Compound Name | N-(cyclohexylmethyl)-2-[2-(trifluoromethyl)phenyl]ethanamine;2-N,4-N,4-N-trimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142230606 |
| Molecular Formula | C27H36F3N5 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2-(trifluoromethyl)phenyl]ethanamine;2-N,4-N,4-N-trimethylquinazoline-2,4-diamine |
| SMILES | CNc1nc(N(C)C)c2ccccc2n1.FC(F)(F)c1ccccc1CCNCC1CCCCC1 |
| InChI | InChI=1S/C16H22F3N.C11H14N4/c17-16(18,19)15-9-5-4-8-14(15)10-11-20-12-13-6-2-1-3-7-13;1-12-11-13-9-7-5-4-6-8(9)10(14-11)15(2)3/h4-5,8-9,13,20H,1-3,6-7,10-12H2;4-7H,1-3H3,(H,12,13,14) |
| InChIKey | BALNASWXIJGSMH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|