C23H30BrClN6O2S — CID 142228889
5-bromo-6-chloro-N-methylpyridine-3-sulfonamide;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 142228889) has the molecular formula C23H30BrClN6O2S and a molecular weight of 569.96 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-methylpyridine-3-sulfonamide;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 5-bromo-6-chloro-N-methylpyridine-3-sulfonamide;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142228889 |
| Molecular Formula | C23H30BrClN6O2S |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 5-bromo-6-chloro-N-methylpyridine-3-sulfonamide;2-N-(cyclohexylmethyl)-4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(NCC2CCCCC2)nc2ccccc12.CNS(=O)(=O)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C17H24N4.C6H6BrClN2O2S/c1-21(2)16-14-10-6-7-11-15(14)19-17(20-16)18-12-13-8-4-3-5-9-13;1-9-13(11,12)4-2-5(7)6(8)10-3-4/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,18,19,20);2-3,9H,1H3 |
| InChIKey | ZXOWOFNILRKCEC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|