C28H37ClN6OS — CID 142229357
N-[2-chloro-4-[(E)-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylamino]-ethylidene-λ4-sulfanyl]phenyl]acetamide (PubChem CID 142229357) has the molecular formula C28H37ClN6OS and a molecular weight of 541.17 g/mol. Its IUPAC name is N-[2-chloro-4-[(E)-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylamino]-ethylidene-λ4-sulfanyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[(E)-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylamino]-ethylidene-λ4-sulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142229357 |
| Molecular Formula | C28H37ClN6OS |
| Molecular Weight | 541.17 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | N-[2-chloro-4-[(E)-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylamino]-ethylidene-λ4-sulfanyl]phenyl]acetamide |
| SMILES | C/C=S(/NCC1CCC(CNc2nc(N(C)C)c3ccccc3n2)CC1)c1ccc(NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C28H37ClN6OS/c1-5-37(22-14-15-26(24(29)16-22)32-19(2)36)31-18-21-12-10-20(11-13-21)17-30-28-33-25-9-7-6-8-23(25)27(34-28)35(3)4/h5-9,14-16,20-21,31H,10-13,17-18H2,1-4H3,(H,32,36)(H,30,33,34) |
| InChIKey | JTVPMXXEFWOHAM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.17 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|