C24H27Br2FN6S — CID 87849684
1-(2,4-dibromo-6-fluorophenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea (PubChem CID 87849684) has the molecular formula C24H27Br2FN6S and a molecular weight of 610.40 g/mol. Its IUPAC name is 1-(2,4-dibromo-6-fluorophenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea.
| Compound Name | 1-(2,4-dibromo-6-fluorophenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 87849684 |
| Molecular Formula | C24H27Br2FN6S |
| Molecular Weight | 610.40 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 1-(2,4-dibromo-6-fluorophenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(CNC(=S)Nc3c(F)cc(Br)cc3Br)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H27Br2FN6S/c1-33(2)22-17-5-3-4-6-20(17)30-23(32-22)29-16-9-7-14(8-10-16)13-28-24(34)31-21-18(26)11-15(25)12-19(21)27/h3-6,11-12,14,16H,7-10,13H2,1-2H3,(H2,28,31,34)(H,29,30,32) |
| InChIKey | FRKVDLPXOLFXQY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|