C25H31ClN6OS — CID 87612279
1-(5-chloro-2-methoxyphenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea (PubChem CID 87612279) has the molecular formula C25H31ClN6OS and a molecular weight of 499.08 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 87612279 |
| Molecular Formula | C25H31ClN6OS |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)NCC1CCC(Nc2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H31ClN6OS/c1-32(2)23-19-6-4-5-7-20(19)29-24(31-23)28-18-11-8-16(9-12-18)15-27-25(34)30-21-14-17(26)10-13-22(21)33-3/h4-7,10,13-14,16,18H,8-9,11-12,15H2,1-3H3,(H2,27,30,34)(H,28,29,31) |
| InChIKey | ZTBXTVZTXPWKRI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|